For research use only. Not for therapeutic Use.
4-Bromo-2-methyl-1H-indole is a nitrogen-containing heterocyclic compound characterized by an indole structure with a bromine atom at the 4-position and a methyl group at the 2-position. This unique arrangement of substituents imparts distinctive electronic properties, making it of interest in organic synthesis and medicinal chemistry. The compound may exhibit biological activity, potentially serving as a scaffold for developing novel pharmaceuticals. Its bromine and methyl groups enhance its reactivity, allowing for various modifications in chemical research and applications.
Catalog Number | L041017 |
CAS Number | 6127-18-0 |
Molecular Formula | C9H8BrN |
Purity | ≥95% |
IUPAC Name | 4-bromo-2-methyl-1H-indole |
InChI | InChI=1S/C9H8BrN/c1-6-5-7-8(10)3-2-4-9(7)11-6/h2-5,11H,1H3 |
InChIKey | MXRPXKYWAYTGJY-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(N1)C=CC=C2Br |