For research use only. Not for therapeutic Use.
4-Bromo-2-picoline is a halogenated derivative of picoline, featuring a bromine atom at the 4th position and a methyl group at the 2nd position on the pyridine ring. This compound is commonly used in organic synthesis as a building block for more complex molecules, particularly in pharmaceutical and agrochemical development. The presence of the bromine atom enhances its reactivity, allowing for cross-coupling reactions and other modifications. Researchers explore its applications in drug discovery, materials science, and chemical synthesis.
CAS Number | 22282-99-1 |
Synonyms | 2-Methyl-4-bromopyridine; 4-Bromo-2-methylpyridine; |
Molecular Formula | C6H6BrN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-bromo-2-methylpyridine |
InChI | InChI=1S/C6H6BrN/c1-5-4-6(7)2-3-8-5/h2-4H,1H3 |
InChIKey | JFBMFWHEXBLFCR-UHFFFAOYSA-N |
SMILES | CC1=NC=CC(=C1)Br |