For research use only. Not for therapeutic Use.
4-Bromo-2-pyrrolecarboxaldehyde is a valuable heterocyclic compound characterized by its bromine substitution and aldehyde functional group. This compound serves as an important building block in organic synthesis, particularly in the development of various pharmaceuticals and agrochemicals. Its unique pyrrole ring enhances its reactivity, facilitating diverse chemical transformations. Researchers are exploring its applications in synthesizing novel materials and biologically active compounds, contributing to advancements in medicinal chemistry and materials science. The compound’s intriguing properties make it a subject of ongoing study in chemical research.
CAS Number | 931-33-9 |
Synonyms | 4-Bromo-1H-pyrrole-2-carboxaldehyde; 4-Bromopyrrole-2-carboxaldehyde; |
Molecular Formula | C5H4BrNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-bromo-1H-pyrrole-2-carbaldehyde |
InChI | InChI=1S/C5H4BrNO/c6-4-1-5(3-8)7-2-4/h1-3,7H |
InChIKey | RFQYNGQAZZSGFM-UHFFFAOYSA-N |
SMILES | C1=C(NC=C1Br)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |