For research use only. Not for therapeutic Use.
4-Bromo-2-(trifluoromethyl)benzaldehyde(CAT: L043007) is a high-purity aromatic aldehyde widely utilized in pharmaceutical, agrochemical, and material science research. Featuring a brominated benzaldehyde structure with a trifluoromethyl group, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, specialty chemicals, and advanced materials. Its unique combination of functional groups makes it particularly valuable in medicinal chemistry for the development of therapeutic agents and in cross-coupling reactions such as Suzuki-Miyaura. With excellent stability and reactivity, 4-Bromo-2-(trifluoromethyl)benzaldehyde ensures precision and reliability, making it an essential tool for innovative research and advanced synthetic applications.
CAS Number | 861928-27-0 |
Molecular Formula | C8H4BrF3O |
Purity | ≥95% |
IUPAC Name | 4-bromo-2-(trifluoromethyl)benzaldehyde |
InChI | InChI=1S/C8H4BrF3O/c9-6-2-1-5(4-13)7(3-6)8(10,11)12/h1-4H |
InChIKey | PROPHDFGNNBHJX-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)C=O |