For research use only. Not for therapeutic Use.
4-Bromo-2,3,6-trimethylphenol (Cat.No:L003507) is a vital chemical compound with diverse applications. It serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and reactivity make it an important building block in organic synthesis. Additionally, its bromine substituent imparts valuable properties, broadening its utility in various industries.
Catalog Number | L003507 |
CAS Number | 51857-41-1 |
Molecular Formula | C9H11BrO |
Purity | ≥95% |
IUPAC Name | 4-bromo-2,3,6-trimethylphenol |
InChI | InChI=1S/C9H11BrO/c1-5-4-8(10)6(2)7(3)9(5)11/h4,11H,1-3H3 |
InChIKey | CNZUMQRUUPCHJR-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C(=C1O)C)C)Br |