For research use only. Not for therapeutic Use.
4-Bromo-2,5-difluorophenylboronic acid(CAT: L028584) is a versatile boronic acid derivative widely used in organic synthesis and pharmaceutical research. Its structure, featuring bromine and fluorine substituents on a phenyl ring, provides unique reactivity for Suzuki-Miyaura cross-coupling reactions. This compound is particularly valuable in the development of complex molecules, including pharmaceutical intermediates and agrochemicals. With high purity and stability, 4-Bromo-2,5-difluorophenylboronic acid enables precise and efficient chemical transformations, supporting advanced research in medicinal chemistry, material science, and the synthesis of fluorinated aromatic compounds.
CAS Number | 1106676-82-7 |
Molecular Formula | C6H4BBrF2O2 |
Purity | ≥95% |
IUPAC Name | (4-bromo-2,5-difluorophenyl)boronic acid |
InChI | InChI=1S/C6H4BBrF2O2/c8-4-2-5(9)3(7(11)12)1-6(4)10/h1-2,11-12H |
InChIKey | RWBIJRFCSHAOGQ-UHFFFAOYSA-N |
SMILES | B(C1=CC(=C(C=C1F)Br)F)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |