For research use only. Not for therapeutic Use.
4-Bromo-2,6-di-tert-butylphenol(Cat No.:M046797)is a brominated phenol derivative with bulky tert-butyl groups at the 2 and 6 positions and a bromine atom at the 4 position. This compound is widely used in the synthesis of antioxidants, stabilizers, and other specialty chemicals, particularly in the polymer and pharmaceutical industries. The bulky tert-butyl groups provide steric hindrance, enhancing the stability of the phenol, while the bromine atom allows for further chemical modifications. Its high purity and reactivity make it valuable for advanced research in organic synthesis and material science.
CAS Number | 1139-52-2 |
Molecular Formula | C14H21BrO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-bromo-2,6-ditert-butylphenol |
InChI | InChI=1S/C14H21BrO/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7-8,16H,1-6H3 |
InChIKey | SSQQUEKFNSJLKX-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)Br |