For research use only. Not for therapeutic Use.
4-Bromo-2,6-dichloroaniline(Cat No.:L038641)is a specialized organic compound widely utilized in pharmaceutical and chemical research. Featuring bromine and chlorine atoms attached to an aniline ring, this compound is an essential building block in the synthesis of complex molecules, particularly in the development of pharmaceuticals and agrochemicals. Its unique halogenated structure allows for diverse chemical modifications, making it valuable for creating various derivatives. 4-Bromo-2,6-dichloroaniline is crucial for high-precision synthesis and innovative research, supporting the advancement of new therapeutic agents and chemical products.
CAS Number | 697-88-1 |
Molecular Formula | C6H4BrCl2N |
Purity | ≥95% |
IUPAC Name | 4-bromo-2,6-dichloroaniline |
InChI | InChI=1S/C6H4BrCl2N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
InChIKey | NPQBZKNXJZARBJ-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1Cl)N)Cl)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |