For research use only. Not for therapeutic Use.
4-Bromo-3-chloro-1H-pyrazolo[3,4-b]pyridine(CAT: L021419) is a halogenated heterocyclic compound commonly used in pharmaceutical and chemical research. Its structure, characterized by a fused pyrazolo-pyridine ring system with bromine and chlorine substituents at the 4- and 3-positions respectively, provides significant reactivity and versatility for synthetic applications. This compound serves as a valuable building block in the development of kinase inhibitors, antiviral agents, and other bioactive molecules. Its halogen substitutions enhance the potential for selective modifications through coupling reactions. Researchers employ 4-Bromo-3-chloro-1H-pyrazolo[3,4-b]pyridine in medicinal chemistry and structure-activity relationship (SAR) studies for creating innovative therapeutic agents.
CAS Number | 1956385-09-3 |
Molecular Formula | C6H3BrClN3 |
Purity | ≥95% |
IUPAC Name | 4-bromo-3-chloro-2H-pyrazolo[3,4-b]pyridine |
InChI | InChI=1S/C6H3BrClN3/c7-3-1-2-9-6-4(3)5(8)10-11-6/h1-2H,(H,9,10,11) |
InChIKey | JAMOFCAXIPDRKX-UHFFFAOYSA-N |
SMILES | C1=C(C2=C(NN=C2N=C1)Cl)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |