For research use only. Not for therapeutic Use.
4-Bromo-3-fluorobenzaldehyde(Cat No.:M112481), is a chemical compound with the molecular formula C7H4BrFO. It belongs to the class of benzaldehyde derivatives and is characterized by the presence of both bromine and fluorine atoms on the benzene ring. This compound’s unique structure makes it valuable in various organic synthesis processes, enabling the creation of more complex molecules through functional group transformations. It could find applications in the production of pharmaceuticals, agrochemicals, and materials with tailored properties due to its specific reactivity and potential for building diverse molecular architectures.
CAS Number | 133059-43-5 |
Molecular Formula | C7H4BrFO |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 4-bromo-3-fluorobenzaldehyde |
InChI | InChI=1S/C7H4BrFO/c8-6-2-1-5(4-10)3-7(6)9/h1-4H |
InChIKey | SWHUROFMIMHWKS-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C=O)F)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |