For research use only. Not for therapeutic Use.
4-Bromo-3-fluorobenzoic acid (Cat.No:M100898) is a chemical compound used as a building block in organic synthesis. It contains a bromine atom and a fluorine atom attached to a benzoic acid structure. This compound is valuable in creating diverse molecules for pharmaceuticals, agrochemicals, and materials, contributing to scientific research and industrial applications.
CAS Number | 153556-42-4 |
Molecular Formula | C7H4BrFO2 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 4-bromo-3-fluorobenzoic acid |
InChI | InChI=1S/C7H4BrFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) |
InChIKey | RMYOGXPGIDWJLU-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(=O)O)F)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |