For research use only. Not for therapeutic Use.
4-Bromo-3-fluoropicolinaldehyde(CAT: L002303) is a halogenated picolinaldehyde derivative featuring both bromine and fluorine substituents on the pyridine ring, with an aldehyde group at the 2-position. This compound is valuable in organic synthesis, particularly in medicinal and agrochemical research, due to its reactivity and functional versatility. The bromine and fluorine atoms enable selective functionalization, often used in cross-coupling reactions to construct more complex molecules. The aldehyde group further broadens its applicability, allowing for modifications through condensation and reduction reactions. 4-Bromo-3-fluoropicolinaldehyde serves as a useful intermediate in the synthesis of heterocyclic compounds with potential bioactive properties.
CAS Number | 1289148-65-7 |
Molecular Formula | C6H3BrFNO |
Purity | ≥95% |
IUPAC Name | 4-bromo-3-fluoropyridine-2-carbaldehyde |
InChI | InChI=1S/C6H3BrFNO/c7-4-1-2-9-5(3-10)6(4)8/h1-3H |
InChIKey | QDSZNUHQAFSZCE-UHFFFAOYSA-N |