For research use only. Not for therapeutic Use.
4-Bromo-3-(fluorosulfonyl)benzoic acid(Cat No.:L007662), is a chemical compound featuring a benzoic acid core substituted with a bromine atom at the 4-position and a fluorosulfonyl group at the 3-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a key intermediate for the creation of diverse organic molecules, especially in the development of pharmaceuticals and fine chemicals. Its versatile nature allows for various chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery, research purposes, and industrial applications, contributing to advancements in medicinal chemistry research and chemical development.
CAS Number | 1935922-41-0 |
Molecular Formula | C7H4BrFO4S |
Purity | ≥95% |
IUPAC Name | 4-bromo-3-fluorosulfonylbenzoic acid |
InChI | InChI=1S/C7H4BrFO4S/c8-5-2-1-4(7(10)11)3-6(5)14(9,12)13/h1-3H,(H,10,11) |
InChIKey | WPZTZMWUYUGLKJ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(=O)O)S(=O)(=O)F)Br |