For research use only. Not for therapeutic Use.
4-Bromo-3-hydroxybenzaldehyde is a chemical compound used in organic synthesis as a building block for various pharmaceuticals and agrochemicals. Its bromine-substituted benzaldehyde moiety imparts unique reactivity, enabling the synthesis of diverse molecules. Research indicates its potential in medicinal chemistry for developing novel drugs with targeted biological activities. 4-Bromo-3-hydroxybenzaldehyde’s versatility and synthetic utility make it valuable in drug discovery and development processes.
Catalog Number | R072245 |
CAS Number | 20035-32-9 |
Molecular Formula | C7H5BrO2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-3-hydroxybenzaldehyde |
InChI | InChI=1S/C7H5BrO2/c8-6-2-1-5(4-9)3-7(6)10/h1-4,10H |
InChIKey | USCBCBWUZOPHNV-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C=O)O)Br |