For research use only. Not for therapeutic Use.
4-Bromo-3-hydroxybenzoic Acid(Cat No.:R042113)is a brominated aromatic compound featuring both hydroxyl and carboxyl groups, making it valuable in organic synthesis. This versatile building block is commonly used in the preparation of pharmaceuticals, agrochemicals, and various fine chemicals. Its structural properties allow for easy derivatization, facilitating the development of more complex molecules. Additionally, 4-Bromo-3-hydroxybenzoic Acid serves as a key intermediate in the synthesis of biologically active compounds, making it essential for researchers in medicinal chemistry and drug discovery.
CAS Number | 14348-38-0 |
Molecular Formula | C7H5BrO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 4-bromo-3-hydroxybenzoic acid |
InChI | InChI=1S/C7H5BrO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11) |
InChIKey | PAJSESFUWIYFNF-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(=O)O)O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |