For research use only. Not for therapeutic Use.
4-Bromo-3-methylphenol (Cat.No:R014599) is a chemical compound used in various industrial applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. It possesses both bromine and methyl functional groups, which make it valuable in the creation of specialized molecules for specific purposes in research and manufacturing processes.
CAS Number | 14472-14-1 |
Synonyms | 2-Bromo-5-hydroxytoluene; 3-Methyl-4-bromophenol; 4-Bromo-m-cresol; p-Bromo-m-xylenol |
Molecular Formula | C7H7BrO |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-bromo-3-methylphenol |
InChI | InChI=1S/C7H7BrO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
InChIKey | GPOQODYGMUTOQL-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)O)Br |