For research use only. Not for therapeutic Use.
4-Bromo-3-methylpyrazole is a heterocyclic compound featuring a pyrazole ring with a bromine atom at the 4-position and a methyl group at the 3-position. This compound is commonly used as an intermediate in organic synthesis, particularly for the development of pharmaceuticals, agrochemicals, and bioactive molecules. Its bromine atom provides a reactive site for further functionalization, making it valuable in cross-coupling reactions such as Suzuki or Heck coupling. Researchers utilize 4-Bromo-3-methylpyrazole to synthesize diverse molecular frameworks, including potential therapeutic agents, and to explore its reactivity in medicinal and chemical research.
CAS Number | 13808-64-5 |
Synonyms | 3-Methyl-4-bromopyrazole; 4-Bromo-3-methyl-1H-pyrazole; NSC 50563 |
Molecular Formula | C4H5BrN2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-bromo-5-methyl-1H-pyrazole |
InChI | InChI=1S/C4H5BrN2/c1-3-4(5)2-6-7-3/h2H,1H3,(H,6,7) |
InChIKey | IXQPRETWBGVNPJ-UHFFFAOYSA-N |
SMILES | CC1=C(C=NN1)Br |