For research use only. Not for therapeutic Use.
4-Bromo-3-(trifluoromethoxy)toluene(CAT: L002996) is a high-purity aromatic compound featuring a bromine atom, a trifluoromethoxy group, and a methyl substituent on a benzene ring. This compound is widely utilized in pharmaceutical research and organic synthesis as a versatile building block for creating bioactive molecules and advanced materials. Its unique structure and reactivity make it valuable for medicinal chemistry applications, including the development of therapeutic agents and specialty chemicals. With excellent stability and precise composition, 4-Bromo-3-(trifluoromethoxy)toluene ensures reliable and consistent performance, making it an essential resource for researchers and innovators in drug discovery and complex chemical synthesis.
CAS Number | 2166854-28-8 |
Molecular Formula | C8H6BrF3O |
Purity | ≥95% |
IUPAC Name | 1-bromo-4-methyl-2-(trifluoromethoxy)benzene |
InChI | InChI=1S/C8H6BrF3O/c1-5-2-3-6(9)7(4-5)13-8(10,11)12/h2-4H,1H3 |
InChIKey | VTFZOAJPIPNXTB-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)Br)OC(F)(F)F |