For research use only. Not for therapeutic Use.
4-Bromo-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine(Cat No.:L032736)is a versatile heterocyclic compound used in pharmaceutical research and organic synthesis. The molecule features a pyrrolo[2,3-b]pyridine core with a bromine atom at the 4-position and a trifluoromethyl group at the 3-position, providing unique reactivity and electronic properties. This compound is particularly valuable as a building block in the synthesis of kinase inhibitors and other biologically active molecules. Its structural features make it ideal for creating complex molecular frameworks, essential for drug discovery and the development of advanced therapeutic agents.
CAS Number | 1256824-06-2 |
Molecular Formula | C8H4BrF3N2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
InChI | InChI=1S/C8H4BrF3N2/c9-5-1-2-13-7-6(5)4(3-14-7)8(10,11)12/h1-3H,(H,13,14) |
InChIKey | ANLSLNIHKSZKLF-UHFFFAOYSA-N |
SMILES | C1=CN=C2C(=C1Br)C(=CN2)C(F)(F)F |