For research use only. Not for therapeutic Use.
4-Bromo-3,5-dimethylphenylboronic acid (CAT: L000187) is a valuable compound with applications primarily in organic chemistry. Its action mechanism involves its role as a boronic acid derivative, making it a versatile building block for various chemical reactions. In the field of organic chemistry, this compound is instrumental in the synthesis of complex organic molecules, including pharmaceutical intermediates and specialty chemicals. It plays a crucial role in the development of potential drugs, particularly in the pharmaceutical industry, facilitating the creation of novel therapeutic compounds.
CAS Number | 1451391-45-9 |
Molecular Formula | C8H10BBrO2 |
Purity | ≥95% |
IUPAC Name | (4-bromo-3,5-dimethylphenyl)boronic acid |
InChI | InChI=1S/C8H10BBrO2/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4,11-12H,1-2H3 |
InChIKey | RJGXQMYJURBWIO-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |