For research use only. Not for therapeutic Use.
4-Bromo-4′-fluorobenzophenone(Cat No.:L037044)is an aromatic ketone used in organic synthesis and pharmaceutical research. The molecule features a benzophenone core with a bromine atom at the 4-position on one phenyl ring and a fluorine atom at the 4′-position on the other phenyl ring. This combination of halogens provides unique reactivity, making it a valuable intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals, agrochemicals, and fine chemicals. Its structure allows for versatile chemical modifications, essential for researchers focused on drug discovery, medicinal chemistry, and the creation of advanced materials.
CAS Number | 2069-41-2 |
Molecular Formula | C13H8BrFO |
Purity | ≥95% |
IUPAC Name | (4-bromophenyl)-(4-fluorophenyl)methanone |
InChI | InChI=1S/C13H8BrFO/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
InChIKey | SSXSFTBOKUQUAX-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)Br)F |