For research use only. Not for therapeutic Use.
4-Bromo-5-chloro-2-methylpyridine is a halogenated pyridine derivative used as an intermediate in organic synthesis and pharmaceutical research. With bromine, chlorine, and methyl substitutions on the pyridine ring, it offers unique reactivity, making it valuable for creating complex molecules, particularly in the development of agrochemicals and pharmaceuticals. This compound is frequently employed in cross-coupling reactions and other chemical modifications, contributing to the synthesis of bioactive molecules and supporting advancements in medicinal chemistry and chemical manufacturing.
CAS Number | 1211529-34-8 |
Synonyms | 4-BroMo-5-chloro-2-Methylpyridine |
Molecular Formula | C6H5BrClN |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 4-bromo-5-chloro-2-methylpyridine |
InChI | InChI=1S/C6H5BrClN/c1-4-2-5(7)6(8)3-9-4/h2-3H,1H3 |
InChIKey | HNVMDSYZOIIFLJ-UHFFFAOYSA-N |
SMILES | CC1=NC=C(C(=C1)Br)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |