For research use only. Not for therapeutic Use.
4-Bromo-5-chloronaphthalen-2-ol(CAT: L000370) is a compound with potential applications in both pharmaceutical and material chemistry. Its unique halogenated naphthalenol structure makes it a valuable intermediate for the synthesis of organic compounds, particularly in the field of material chemistry. This compound can be employed in the creation of materials with specific optical or electronic properties.
CAS Number | 2454397-73-8 |
Molecular Formula | C10H6BrClO |
Purity | ≥95% |
IUPAC Name | 4-bromo-5-chloronaphthalen-2-ol |
InChI | InChI=1S/C10H6BrClO/c11-8-5-7(13)4-6-2-1-3-9(12)10(6)8/h1-5,13H |
InChIKey | IDUFRSRWLZNLOM-UHFFFAOYSA-N |