For research use only. Not for therapeutic Use.
4-Bromo-5-chloropyridin-2-amine(Cat No.:L027035)is a halogenated pyridine derivative commonly used in pharmaceutical research and organic synthesis. Featuring both bromine and chlorine atoms attached to the pyridine ring, this compound serves as a versatile building block in the development of various biologically active molecules, including potential drug candidates. Its dual halogenation provides unique reactivity, making it suitable for a range of chemical transformations, such as cross-coupling reactions and nucleophilic substitutions. Researchers in medicinal chemistry utilize this compound to create innovative compounds for drug discovery and advanced material applications.
CAS Number | 1187449-01-9 |
Molecular Formula | C5H4BrClN2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-5-chloropyridin-2-amine |
InChI | InChI=1S/C5H4BrClN2/c6-3-1-5(8)9-2-4(3)7/h1-2H,(H2,8,9) |
InChIKey | VIZMARKIEQIMIG-UHFFFAOYSA-N |
SMILES | C1=C(C(=CN=C1N)Cl)Br |