For research use only. Not for therapeutic Use.
4-Bromo-5-chloropyridin-3-amine(Cat No.:L007787), is a chemical compound with the molecular formula C₅H₄BrClN₂. This compound consists of a pyridine ring with bromine (Br), chlorine (Cl), and amino (NH₂) functional groups attached at different positions. Chemicals with similar structures are often used as building blocks in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and specialty chemicals. The specific arrangement of atoms in this compound makes it valuable for medicinal chemistry research, as it can potentially serve as a precursor or intermediate in the creation of biologically active molecules.
CAS Number | 1802434-30-5 |
Molecular Formula | C5H4BrClN2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-5-chloropyridin-3-amine |
InChI | InChI=1S/C5H4BrClN2/c6-5-3(7)1-9-2-4(5)8/h1-2H,8H2 |
InChIKey | XUZVZOWANQYHSJ-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(C=N1)Cl)Br)N |