For research use only. Not for therapeutic Use.
4-Bromo-5-fluoro-2-hydroxybenzaldehyde (Cat.No:L003940) is a crucial compound in organic synthesis. Its unique structure, featuring both bromine and fluorine substituents, imparts distinctive reactivity and properties. This compound is utilized as a key intermediate in the preparation of specialized organic molecules with various industrial and pharmaceutical applications.
Catalog Number | L003940 |
CAS Number | 1427405-76-2 |
Molecular Formula | C7H4BrFO2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-5-fluoro-2-hydroxybenzaldehyde |
InChI | InChI=1S/C7H4BrFO2/c8-5-2-7(11)4(3-10)1-6(5)9/h1-3,11H |
InChIKey | KZXYTQOZAFEXTM-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1F)Br)O)C=O |