For research use only. Not for therapeutic Use.
4-Bromo-5-fluoroisoquinoline (Cat.No:L003911) is a pivotal chemical compound with versatile applications. Its unique structure, combining bromine and fluorine substituents on an isoquinoline scaffold, imparts distinctive reactivity. This compound is utilized as a valuable building block in the synthesis of specialized organic molecules with applications in pharmaceutical and agrochemical research.
Catalog Number | L003911 |
CAS Number | 351457-58-4 |
Molecular Formula | C9H5BrFN |
Purity | ≥95% |
IUPAC Name | 4-bromo-5-fluoroisoquinoline |
InChI | InChI=1S/C9H5BrFN/c10-7-5-12-4-6-2-1-3-8(11)9(6)7/h1-5H |
InChIKey | BIKQXDIDVOSHHU-UHFFFAOYSA-N |
SMILES | C1=CC2=CN=CC(=C2C(=C1)F)Br |