For research use only. Not for therapeutic Use.
4-Bromo-5-methoxybenzofuran (Cat.No:L003602) is a notable chemical compound known for its diverse applications in medicinal chemistry. Its unique structure and reactivity make it a valuable scaffold for the synthesis of biologically active molecules. This compound has garnered attention for its potential therapeutic properties and is actively studied in drug discovery efforts.
CAS Number | 36826-30-9 |
Molecular Formula | C9H7BrO2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-5-methoxy-1-benzofuran |
InChI | InChI=1S/C9H7BrO2/c1-11-8-3-2-7-6(9(8)10)4-5-12-7/h2-5H,1H3 |
InChIKey | JTXHHUAASZOKGT-UHFFFAOYSA-N |
SMILES | COC1=C(C2=C(C=C1)OC=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |