For research use only. Not for therapeutic Use.
4-Bromo-5-methyl-2-thiazolamine(Cat No.:M089409)is a specialized chemical compound used in pharmaceutical and biochemical research. With a thiazole ring structure substituted with a bromine atom and a methyl group, this compound is crucial in the synthesis of various bioactive molecules and intermediates. It is particularly valuable in the development of new therapeutic agents and in the study of biological pathways involving thiazole derivatives. Its reactivity and stability make it an essential tool in medicinal chemistry, supporting innovative research and drug discovery efforts.
CAS Number | 1209167-05-4 |
Synonyms | 4-Bromo-5-methyl-2-thiazolamine |
Molecular Formula | C4H5BrN2S |
Purity | ≥95% |
IUPAC Name | 4-bromo-5-methyl-1,3-thiazol-2-amine |
InChI | InChI=1S/C4H5BrN2S/c1-2-3(5)7-4(6)8-2/h1H3,(H2,6,7) |
InChIKey | KPTFKWPRFDQHJL-UHFFFAOYSA-N |
SMILES | CC1=C(N=C(S1)N)Br |