For research use only. Not for therapeutic Use.
4-Bromo-6-chloronicotinonitrile(CAT: L011597) is a halogenated heterocyclic compound with a nitrile functional group, widely utilized in pharmaceutical and agrochemical research. Its unique structure, combining bromine, chlorine, and a pyridine ring, makes it an essential intermediate for the synthesis of complex molecules, including bioactive compounds and advanced materials. This compound is particularly valuable in medicinal chemistry for designing novel therapeutic agents. With high purity and reliable quality, 4-Bromo-6-chloronicotinonitrile supports innovative research in drug development, organic synthesis, and material science applications.
CAS Number | 1354021-07-0 |
Molecular Formula | C6H2BrClN2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-6-chloropyridine-3-carbonitrile |
InChI | InChI=1S/C6H2BrClN2/c7-5-1-6(8)10-3-4(5)2-9/h1,3H |
InChIKey | SDBOUCULKBNTGZ-UHFFFAOYSA-N |
SMILES | C1=C(C(=CN=C1Cl)C#N)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |