For research use only. Not for therapeutic Use.
4-Bromo-6-methyl-1H-indole(Cat No.:L034997)is an important heterocyclic compound used in organic synthesis and pharmaceutical research. The indole core, substituted with a bromine atom at the 4-position and a methyl group at the 6-position, offers unique reactivity, making it valuable as a building block for creating complex molecules. This compound is particularly useful in the development of biologically active substances, such as kinase inhibitors and other therapeutic agents. Its structural features allow for versatile chemical modifications, making it essential for researchers focused on drug discovery and advanced synthetic chemistry.
CAS Number | 885520-48-9 |
Molecular Formula | C9H8BrN |
Purity | ≥95% |
IUPAC Name | 4-bromo-6-methyl-1H-indole |
InChI | InChI=1S/C9H8BrN/c1-6-4-8(10)7-2-3-11-9(7)5-6/h2-5,11H,1H3 |
InChIKey | SNVJZMYSWAVFCK-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=CN2)C(=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |