For research use only. Not for therapeutic Use.
4-Bromo-6-methyl-1H-pyrrolo[2,3-b]pyridine(Cat No.:L044708)is a heterocyclic compound featuring a pyrrolopyridine core with a bromine atom at the 4-position and a methyl group at the 6-position. This compound is widely used in pharmaceutical research and organic synthesis as a key intermediate in the development of biologically active molecules, including potential drug candidates. Its brominated structure allows for versatile reactivity, particularly in cross-coupling reactions. Researchers in medicinal chemistry value this compound for its role in creating complex heterocycles and exploring innovative therapeutic agents.
CAS Number | 1000340-58-8 |
Molecular Formula | C8H7BrN2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-6-methyl-1H-pyrrolo[2,3-b]pyridine |
InChI | InChI=1S/C8H7BrN2/c1-5-4-7(9)6-2-3-10-8(6)11-5/h2-4H,1H3,(H,10,11) |
InChIKey | WNZFMSGWHBWYFS-UHFFFAOYSA-N |
SMILES | CC1=CC(=C2C=CNC2=N1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |