For research use only. Not for therapeutic Use.
4-Bromo-6-(trifluoromethyl)nicotinaldehyde(Cat No.:L023382)is a complex aromatic compound featuring a nicotinic aldehyde structure substituted with bromo and trifluoromethyl groups. This compound is highly valued in organic synthesis for its reactivity, particularly in forming C-C bonds and Schiff bases. The trifluoromethyl group enhances the compound’s electronegativity and metabolic stability, making it particularly useful in pharmaceutical chemistry for synthesizing molecules with increased bioavailability and drug-like properties. 4-Bromo-6-(trifluoromethyl)nicotinaldehyde is crucial in developing new therapeutic agents, especially those targeting neurological disorders and cancers, due to its versatile chemical framework.
CAS Number | 1060810-63-0 |
Molecular Formula | C7H3BrF3NO |
Purity | ≥95% |
IUPAC Name | 4-bromo-6-(trifluoromethyl)pyridine-3-carbaldehyde |
InChI | InChI=1S/C7H3BrF3NO/c8-5-1-6(7(9,10)11)12-2-4(5)3-13/h1-3H |
InChIKey | QVZVEWCPNLENSL-UHFFFAOYSA-N |
SMILES | C1=C(C(=CN=C1C(F)(F)F)C=O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |