For research use only. Not for therapeutic Use.
4-Bromo-7-chloro-2-methylquinoline(Cat No.:L019201)is a halogenated heterocyclic compound with significant applications in pharmaceutical and chemical research. Featuring a quinoline ring with a bromine atom at the 4-position, a chlorine atom at the 7-position, and a methyl group at the 2-position, this compound is a valuable intermediate in the synthesis of various bioactive molecules, including potential therapeutic agents and agrochemicals. Its unique structure allows for selective chemical reactions, making it essential in developing complex organic compounds. It plays a crucial role in medicinal chemistry and advanced material science.
CAS Number | 1070879-51-4 |
Molecular Formula | C10H7BrClN |
Purity | ≥95% |
IUPAC Name | 4-bromo-7-chloro-2-methylquinoline |
InChI | InChI=1S/C10H7BrClN/c1-6-4-9(11)8-3-2-7(12)5-10(8)13-6/h2-5H,1H3 |
InChIKey | CTTIWQURANSXAG-UHFFFAOYSA-N |
SMILES | CC1=CC(=C2C=CC(=CC2=N1)Cl)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |