For research use only. Not for therapeutic Use.
4-Bromo-7-fluoroisoquinoline(Cat No.:L027646)is a halogenated heterocyclic compound used in pharmaceutical and chemical research. Featuring a bromine atom at the 4-position and a fluorine atom at the 7-position on the isoquinoline ring, this compound serves as a versatile building block for synthesizing bioactive molecules, including potential drug candidates. Its unique structure allows for various chemical modifications, making it valuable in the development of complex organic compounds, particularly in drug discovery and development. 4-Bromo-7-fluoroisoquinoline is essential for researchers focused on innovative medicinal chemistry and synthetic methodologies.
CAS Number | 1416500-77-0 |
Molecular Formula | C9H5BrFN |
Purity | ≥95% |
IUPAC Name | 4-bromo-7-fluoroisoquinoline |
InChI | InChI=1S/C9H5BrFN/c10-9-5-12-4-6-3-7(11)1-2-8(6)9/h1-5H |
InChIKey | DXANYJSMNHLBAV-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=NC=C2C=C1F)Br |