For research use only. Not for therapeutic Use.
4-Bromo-7-nitroisoindolin-1-one is a heterocyclic compound featuring an isoindoline structure with a bromine substituent at the 4-position and a nitro group at the 7-position. This unique configuration enhances its chemical reactivity and potential biological activity, making it valuable in organic synthesis and medicinal chemistry. The nitro group can participate in electrophilic substitution reactions, while the bromine atom may facilitate nucleophilic attacks. This compound could serve as an important intermediate in the synthesis of pharmaceuticals and in exploring structure-activity relationships.
CAS Number | 765948-99-0 |
Molecular Formula | C8H5BrN2O3 |
Purity | ≥95% |
IUPAC Name | 4-bromo-7-nitro-2,3-dihydroisoindol-1-one |
InChI | InChI=1S/C8H5BrN2O3/c9-5-1-2-6(11(13)14)7-4(5)3-10-8(7)12/h1-2H,3H2,(H,10,12) |
InChIKey | WQYRRWFXNSLCHC-UHFFFAOYSA-N |
SMILES | C1C2=C(C=CC(=C2C(=O)N1)[N+](=O)[O-])Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |