For research use only. Not for therapeutic Use.
4-Bromo-7-nitroisoquinoline(CAT: L010408) is a high-purity heterocyclic compound widely employed in pharmaceutical and chemical research. Featuring an isoquinoline core with a bromine atom at the 4-position and a nitro group at the 7-position, this compound serves as a versatile intermediate in the synthesis of bioactive molecules and potential drug candidates. Its unique structure and reactivity make it particularly valuable for applications in medicinal chemistry, including the development of enzyme inhibitors, receptor modulators, and other therapeutic agents. 4-Bromo-7-nitroisoquinoline ensures reliable performance and consistency, supporting innovative research in drug discovery and advanced organic synthesis.
CAS Number | 347146-29-6 |
Molecular Formula | C9H5BrN2O2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-7-nitroisoquinoline |
InChI | InChI=1S/C9H5BrN2O2/c10-9-5-11-4-6-3-7(12(13)14)1-2-8(6)9/h1-5H |
InChIKey | IBCREMOZTIARBM-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=NC=C2C=C1[N+](=O)[O-])Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |