For research use only. Not for therapeutic Use.
4-Bromo-7-(trifluoromethyl)isoquinoline is a heterocyclic compound featuring a bromine substituent at the fourth position and a trifluoromethyl group at the seventh position of the isoquinoline ring. This compound exhibits notable electronic and steric properties due to the presence of the trifluoromethyl group, which can enhance its reactivity in various chemical reactions. It is of interest in medicinal chemistry for its potential applications in drug development, particularly in the design of bioactive molecules with improved pharmacological profiles.
CAS Number | 2386466-90-4 |
Molecular Formula | C10H5BrF3N |
Purity | ≥95% |
IUPAC Name | 4-bromo-7-(trifluoromethyl)isoquinoline |
InChI | InChI=1S/C10H5BrF3N/c11-9-5-15-4-6-3-7(10(12,13)14)1-2-8(6)9/h1-5H |
InChIKey | MSGHXBNGLWBPKC-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=NC=C2C=C1C(F)(F)F)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |