For research use only. Not for therapeutic Use.
4-Bromo-9-phenyl-9H-carbazole (Cat.No:L003490) is a crucial chemical compound with versatile applications in materials science and electronics. Its unique molecular structure, incorporating a bromine atom and a phenyl group, imparts specific electronic properties. This compound serves as a valuable building block for organic semiconductors, making it indispensable in the development of advanced electronic devices, such as organic light-emitting diodes (OLEDs) and organic solar cells.
CAS Number | 1097884-37-1 |
Molecular Formula | C18H12BrN |
Purity | ≥95% |
IUPAC Name | 4-bromo-9-phenylcarbazole |
InChI | InChI=1S/C18H12BrN/c19-15-10-6-12-17-18(15)14-9-4-5-11-16(14)20(17)13-7-2-1-3-8-13/h1-12H |
InChIKey | OLLJKISFWSJGID-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)N2C3=C(C4=CC=CC=C42)C(=CC=C3)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |