For research use only. Not for therapeutic Use.
4-Bromo-N-isobutylaniline(Cat No.:L034339)is a key intermediate used in pharmaceutical research and organic synthesis. Featuring a bromine atom on the aniline ring and an isobutyl group attached to the nitrogen, this compound is essential for developing various bioactive molecules, including potential therapeutic agents. Its structure allows for selective reactivity, making it valuable in the synthesis of complex organic compounds and fine chemicals. High purity and consistent quality ensure reliable performance, supporting advanced research in medicinal chemistry and the creation of innovative drugs and materials.
CAS Number | 195968-92-4 |
Molecular Formula | C10H14BrN |
Purity | ≥95% |
IUPAC Name | 4-bromo-N-(2-methylpropyl)aniline |
InChI | InChI=1S/C10H14BrN/c1-8(2)7-12-10-5-3-9(11)4-6-10/h3-6,8,12H,7H2,1-2H3 |
InChIKey | PTPWBSDPHWALGY-UHFFFAOYSA-N |
SMILES | CC(C)CNC1=CC=C(C=C1)Br |