For research use only. Not for therapeutic Use.
4-Bromo-N-methylaniline is an aromatic amine compound used in organic synthesis and pharmaceutical research. Featuring a bromine atom at the 4-position of the aniline ring and a methyl group attached to the nitrogen, this compound serves as a versatile intermediate for creating bioactive molecules, including pharmaceuticals and agrochemicals. It is frequently employed in cross-coupling reactions, such as Suzuki or Heck reactions, allowing for further functionalization. Its reactivity and structure make it a valuable building block in medicinal chemistry and material science.
CAS Number | 6911-87-1 |
Synonyms | 4-Bromo-N-methylbenzenamine; N-Methyl-4-bromoaniline; N-Methyl-p-bromoaniline;?p-Bromo-N-methylaniline; (4-Bromophenyl)methylamine; ?1-Bromo-4-(methylamino)benzene; p-Bromo-N-methylaniline; |
Molecular Formula | C7H8BrN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-bromo-N-methylaniline |
InChI | InChI=1S/C7H8BrN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
InChIKey | AYVPVDWQZAAZCM-UHFFFAOYSA-N |
SMILES | CNC1=CC=C(C=C1)Br |