For research use only. Not for therapeutic Use.
4-Bromo-N-(p-tolyl)aniline is an aromatic compound used in organic synthesis and pharmaceutical research. It consists of an aniline core with a bromine atom at the 4-position and a p-tolyl (para-methylphenyl) group attached to the nitrogen atom. This structure provides unique reactivity, making it valuable as a building block in the synthesis of bioactive molecules and complex organic compounds. It is often employed in cross-coupling reactions and other chemical transformations, contributing to advancements in medicinal chemistry and materials science.
CAS Number | 858516-23-1 |
Molecular Formula | C13H12BrN |
Purity | ≥95% |
IUPAC Name | N-(4-bromophenyl)-4-methylaniline |
InChI | InChI=1S/C13H12BrN/c1-10-2-6-12(7-3-10)15-13-8-4-11(14)5-9-13/h2-9,15H,1H3 |
InChIKey | BGBUEPYWYDNJQN-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |