For research use only. Not for therapeutic Use.
4-Bromo-N,N-dimethylpyridin-2-amine is a high-purity chemical compound used in pharmaceutical and chemical research. Featuring a pyridine backbone with a bromine atom and dimethylamine substitution at the 2-position, it serves as a versatile building block for the synthesis of more complex molecules. Its properties make it useful in the development of biologically active compounds, particularly in the fields of medicinal chemistry and material science. This compound is crucial for studies involving receptor interactions and drug design.
CAS Number | 946000-27-7 |
Molecular Formula | C7H9BrN2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-N,N-dimethylpyridin-2-amine |
InChI | InChI=1S/C7H9BrN2/c1-10(2)7-5-6(8)3-4-9-7/h3-5H,1-2H3 |
InChIKey | HKZMXPYRQCDFCR-UHFFFAOYSA-N |
SMILES | CN(C)C1=NC=CC(=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |