For research use only. Not for therapeutic Use.
4-Bromoaniline-2,3,5,6-d4(Cat No.:R022586 ) is a deuterated form of 4-Bromoaniline, where four hydrogen atoms are replaced with deuterium. This modification significantly improves its analytical properties, making it particularly useful in tracing chemical reactions and studying environmental degradation pathways. Its enhanced stability under experimental conditions allows for more precise measurements in complex chemical systems. This compound is crucial for research in organic synthesis, environmental science, and material development. 4-Bromoaniline-2,3,5,6-d4 serves as an essential reference material for isotopic labeling studies, offering valuable insights into reaction mechanisms and product formations.
CAS Number | 61357-76-4 |
Synonyms | 1-Amino-4-bromobenzene-2,3,5,6-d4; 4-Bromobenzenamine-2,3,5,6-d4; 4-Bromophenylamine-2,3,5,6-d4; NSC 7085-2,3,5,6-d4; p-Aminobromobenzene-2,3,5,6-d4; p-Bromoaniline-2,3,5,6-d4; p-Bromophenylamine-2,3,5,6-d4; |
Molecular Formula | C6H6BrN |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-bromo-2,3,5,6-tetradeuterioaniline |
InChI | InChI=1S/C6H6BrN/c7-5-1-3-6(8)4-2-5/h1-4H,8H2/i1D,2D,3D,4D |
InChIKey | WDFQBORIUYODSI-RHQRLBAQSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])Br)[2H] |