For research use only. Not for therapeutic Use.
4-Bromobenzoic acid-d4(Cat No.:I041463)is a deuterated derivative of 4-bromobenzoic acid, where the hydrogen atoms in the aromatic ring are replaced with deuterium (D). This compound is commonly used in NMR (nuclear magnetic resonance) spectroscopy to study chemical environments and molecular structures due to its distinct isotopic labeling. The presence of deuterium enhances signal resolution in NMR, making it valuable in analytical chemistry, especially in studies involving reaction mechanisms or interactions in organic synthesis. It is also used as a tracer or standard in isotopic labeling experiments.
CAS Number | 787624-24-2 |
Synonyms | 4-bromo-2,3,5,6-tetradeuteriobenzoic acid |
Molecular Formula | C7HD4BrO2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-2,3,5,6-tetradeuteriobenzoic acid |
InChI | InChI=1S/C7H5BrO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H,9,10)/i1D,2D,3D,4D |
InChIKey | TUXYZHVUPGXXQG-RHQRLBAQSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])Br)[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |