For research use only. Not for therapeutic Use.
4-Bromodiphenylamine is an organic compound consisting of a diphenylamine core with a bromine atom at the 4-position. This halogenated aromatic amine is widely used in organic synthesis, particularly for the development of pharmaceuticals, dyes, and agrochemicals. Its bromine substitution allows for further functionalization through cross-coupling reactions, such as Suzuki or Buchwald-Hartwig couplings. The compound’s structure provides versatility in creating new molecules, making it valuable in medicinal chemistry, material science, and various chemical research applications.
| Catalog Number | L011063 |
| CAS Number | 54446-36-5 |
| Molecular Formula | C12H10BrN |
| Purity | ≥95% |
| IUPAC Name | 4-bromo-N-phenylaniline |
| InChI | InChI=1S/C12H10BrN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H |
| InChIKey | CCIVUDMVXNBUCY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)Br |
