For research use only. Not for therapeutic Use.
4-Bromoisophthalic acid (Cat.No:R070177) is a chemical compound used as a versatile building block in organic synthesis. It contains a bromine substituent on the isophthalic acid framework, making it useful for creating various functionalized molecules. Its presence aids in the formation of covalent bonds and the development of novel materials and compounds.
CAS Number | 6939-93-1 |
Molecular Formula | C8H5BrO4 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 4-bromobenzene-1,3-dicarboxylic acid |
InChI | InChI=1S/C8H5BrO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) |
InChIKey | MSQIEZXCNYUWHN-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)Br |