For research use only. Not for therapeutic Use.
4-<wbr></wbr>Bromomethcathinone is a psychoactive compound of the phenethylamine, amphetamine, and cathinone chemical classes. It acts as a serotonin and norepinephrine reuptake inhibitor (IC<sub>50</sub> = 453-<wbr></wbr>430 nM), with properties more similar to an antidepressant than a stimulant. This product is intended for forensic and research applications.
| Catalog Number | R045799 |
| CAS Number | 135333-27-6 |
| Synonyms | 1-(4-Bromophenyl)-2-(methylamino)-1-propanone Hydrochloride |
| Molecular Formula | C10H13BrClNO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(4-bromophenyl)-2-(methylamino)propan-1-one;hydrochloride |
| InChI | InChI=1S/C10H12BrNO.ClH/c1-7(12-2)10(13)8-3-5-9(11)6-4-8;/h3-7,12H,1-2H3;1H |
| InChIKey | TYWLEEFTZLMGNE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Br)NC.Cl |
