For research use only. Not for therapeutic Use.
4-(Bromomethyl)-2-chlorobenzonitrile is an organic compound with the molecular formula C₈H₅BrClN. It features a chlorobenzonitrile structure with a bromomethyl group at the 4-position. This compound typically appears as a solid and is of interest in organic synthesis and medicinal chemistry. Its halogenated structure enhances its reactivity, making it a valuable intermediate for synthesizing various pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, making it a candidate for further research in developing new therapeutic agents.
CAS Number | 83311-25-5 |
Molecular Formula | C8H5BrClN |
Purity | ≥95% |
IUPAC Name | 4-(bromomethyl)-2-chlorobenzonitrile |
InChI | InChI=1S/C8H5BrClN/c9-4-6-1-2-7(5-11)8(10)3-6/h1-3H,4H2 |
InChIKey | MOJPMYDXOHFFPF-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1CBr)Cl)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |