For research use only. Not for therapeutic Use.
4-(Bromomethyl)-2-methoxypyridine hydrobromide(Cat No.:L049154)is a key organic compound used in pharmaceutical and chemical research. Featuring a pyridine ring with a bromomethyl group at the 4-position and a methoxy group at the 2-position, this compound is primarily utilized as an intermediate in the synthesis of bioactive molecules and complex chemical structures. The hydrobromide salt form enhances its stability and solubility, making it suitable for various chemical reactions. Its versatility in functionalization makes it valuable in developing new therapeutic agents and advanced materials.
CAS Number | 2288708-87-0 |
Molecular Formula | C7H9Br2NO |
Purity | ≥95% |
IUPAC Name | 4-(bromomethyl)-2-methoxypyridine;hydrobromide |
InChI | InChI=1S/C7H8BrNO.BrH/c1-10-7-4-6(5-8)2-3-9-7;/h2-4H,5H2,1H3;1H |
InChIKey | DRHVZYMSBGBFCP-UHFFFAOYSA-N |
SMILES | COC1=NC=CC(=C1)CBr.Br |